C20H28FN7O — CID 67003162
3-[[6-[(2-amino-5-fluorophenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]pentan-2-ol (PubChem CID 67003162) has the molecular formula C20H28FN7O and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-[[6-[(2-amino-5-fluorophenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]pentan-2-ol.
| Compound Name | 3-[[6-[(2-amino-5-fluorophenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 67003162 |
| Molecular Formula | C20H28FN7O |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 3-[[6-[(2-amino-5-fluorophenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]pentan-2-ol |
| SMILES | CCC(Nc1nc(NCc2cc(F)ccc2N)c2ncn(C(C)C)c2n1)C(C)O |
| InChI | InChI=1S/C20H28FN7O/c1-5-16(12(4)29)25-20-26-18(17-19(27-20)28(10-24-17)11(2)3)23-9-13-8-14(21)6-7-15(13)22/h6-8,10-12,16,29H,5,9,22H2,1-4H3,(H2,23,25,26,27) |
| InChIKey | YUKCUQYTTMDARP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|