C19H27N7O — CID 46927356
1-[[6-[(2-amino-5-methylphenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]propan-2-ol (PubChem CID 46927356) has the molecular formula C19H27N7O and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-[[6-[(2-amino-5-methylphenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]propan-2-ol.
| Compound Name | 1-[[6-[(2-amino-5-methylphenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 46927356 |
| Molecular Formula | C19H27N7O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 1-[[6-[(2-amino-5-methylphenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]propan-2-ol |
| SMILES | Cc1ccc(N)c(CNc2nc(NCC(C)O)nc3c2ncn3C(C)C)c1 |
| InChI | InChI=1S/C19H27N7O/c1-11(2)26-10-23-16-17(21-9-14-7-12(3)5-6-15(14)20)24-19(25-18(16)26)22-8-13(4)27/h5-7,10-11,13,27H,8-9,20H2,1-4H3,(H2,21,22,24,25) |
| InChIKey | FEILKGWQJSVULK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|