C22H33N7O — CID 46927425
4-[[6-[(2-amino-5-methylphenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]-2-methylpentan-2-ol (PubChem CID 46927425) has the molecular formula C22H33N7O and a molecular weight of 411.55 g/mol. Its IUPAC name is 4-[[6-[(2-amino-5-methylphenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]-2-methylpentan-2-ol.
| Compound Name | 4-[[6-[(2-amino-5-methylphenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 46927425 |
| Molecular Formula | C22H33N7O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.27 |
| IUPAC Name | 4-[[6-[(2-amino-5-methylphenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]-2-methylpentan-2-ol |
| SMILES | Cc1ccc(N)c(CNc2nc(NC(C)CC(C)(C)O)nc3c2ncn3C(C)C)c1 |
| InChI | InChI=1S/C22H33N7O/c1-13(2)29-12-25-18-19(24-11-16-9-14(3)7-8-17(16)23)27-21(28-20(18)29)26-15(4)10-22(5,6)30/h7-9,12-13,15,30H,10-11,23H2,1-6H3,(H2,24,26,27,28) |
| InChIKey | PVEOEJFZFIPNAC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|