C23H31N7 — CID 126746739
6-N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-N-[(3R)-2-methylhex-4-yn-3-yl]-9-propan-2-ylpurine-2,6-diamine (PubChem CID 126746739) has the molecular formula C23H31N7 and a molecular weight of 405.55 g/mol. Its IUPAC name is 6-N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-N-[(3R)-2-methylhex-4-yn-3-yl]-9-propan-2-ylpurine-2,6-diamine.
| Compound Name | 6-N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-N-[(3R)-2-methylhex-4-yn-3-yl]-9-propan-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 126746739 |
| Molecular Formula | C23H31N7 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 6-N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-N-[(3R)-2-methylhex-4-yn-3-yl]-9-propan-2-ylpurine-2,6-diamine |
| SMILES | CC#C[C@H](Nc1nc(NCc2cnc(C)cc2C)c2ncn(C(C)C)c2n1)C(C)C |
| InChI | InChI=1S/C23H31N7/c1-8-9-19(14(2)3)27-23-28-21(20-22(29-23)30(13-26-20)15(4)5)25-12-18-11-24-17(7)10-16(18)6/h10-11,13-15,19H,12H2,1-7H3,(H2,25,27,28,29)/t19-/m0/s1 |
| InChIKey | VUMTWOQTGILLKT-IBGZPJMESA-N |
| XLogP | 4.49 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|