C20H28N6O2 — CID 59098477
4-[[2-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]-2-methylphenol (PubChem CID 59098477) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[[2-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]-2-methylphenol.
| Compound Name | 4-[[2-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]-2-methylphenol |
|---|---|
| PubChem CID | 59098477 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 4-[[2-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]-2-methylphenol |
| SMILES | Cc1cc(Nc2nc(N[C@@H](CO)C(C)C)nc3c2ncn3C(C)C)ccc1O |
| InChI | InChI=1S/C20H28N6O2/c1-11(2)15(9-27)23-20-24-18(22-14-6-7-16(28)13(5)8-14)17-19(25-20)26(10-21-17)12(3)4/h6-8,10-12,15,27-28H,9H2,1-5H3,(H2,22,23,24,25)/t15-/m0/s1 |
| InChIKey | MHQAOEMOKYJEOQ-HNNXBMFYSA-N |
| XLogP | 3.59 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|