C38H57ClN6O3 — CID 90808305
octadeca-9,12-dienyl 2-chloro-4-[[2-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]benzoate (PubChem CID 90808305) has the molecular formula C38H57ClN6O3 and a molecular weight of 681.37 g/mol. Its IUPAC name is octadeca-9,12-dienyl 2-chloro-4-[[2-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]benzoate.
| Compound Name | octadeca-9,12-dienyl 2-chloro-4-[[2-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]benzoate |
|---|---|
| PubChem CID | 90808305 |
| Molecular Formula | C38H57ClN6O3 |
| Molecular Weight | 681.37 g/mol |
| Exact Mass | 680.42 |
| IUPAC Name | octadeca-9,12-dienyl 2-chloro-4-[[2-[[(2R)-1-hydroxy-3-methylbutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]benzoate |
| SMILES | CCCCCC=CCC=CCCCCCCCCOC(=O)c1ccc(Nc2nc(N[C@@H](CO)C(C)C)nc3c2ncn3C(C)C)cc1Cl |
| InChI | InChI=1S/C38H57ClN6O3/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-48-37(47)31-23-22-30(25-32(31)39)41-35-34-36(45(27-40-34)29(4)5)44-38(43-35)42-33(26-46)28(2)3/h10-11,13-14,22-23,25,27-29,33,46H,6-9,12,15-21,24,26H2,1-5H3,(H2,41,42,43,44)/t33-/m0/s1 |
| InChIKey | PGCOWYWGRMJCFY-XIFFEERXSA-N |
| XLogP | 10.20 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.37 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|