C15H17FN6 — CID 59279636
2-fluoro-N-[(6-methyl-3-pyridinyl)methyl]-9-propan-2-ylpurin-6-amine (PubChem CID 59279636) has the molecular formula C15H17FN6 and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-fluoro-N-[(6-methyl-3-pyridinyl)methyl]-9-propan-2-ylpurin-6-amine.
| Compound Name | 2-fluoro-N-[(6-methyl-3-pyridinyl)methyl]-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 59279636 |
| Molecular Formula | C15H17FN6 |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-fluoro-N-[(6-methyl-3-pyridinyl)methyl]-9-propan-2-ylpurin-6-amine |
| SMILES | Cc1ccc(CNc2nc(F)nc3c2ncn3C(C)C)cn1 |
| InChI | InChI=1S/C15H17FN6/c1-9(2)22-8-19-12-13(20-15(16)21-14(12)22)18-7-11-5-4-10(3)17-6-11/h4-6,8-9H,7H2,1-3H3,(H,18,20,21) |
| InChIKey | QVZYJSUBGXEBBR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |