C18H23N5O4S — CID 142640760
2-[6-[(4-methoxyphenyl)methylamino]-9-propan-2-ylpurin-2-yl]sulfonylethanol (PubChem CID 142640760) has the molecular formula C18H23N5O4S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-[6-[(4-methoxyphenyl)methylamino]-9-propan-2-ylpurin-2-yl]sulfonylethanol.
| Compound Name | 2-[6-[(4-methoxyphenyl)methylamino]-9-propan-2-ylpurin-2-yl]sulfonylethanol |
|---|---|
| PubChem CID | 142640760 |
| Molecular Formula | C18H23N5O4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[6-[(4-methoxyphenyl)methylamino]-9-propan-2-ylpurin-2-yl]sulfonylethanol |
| SMILES | COc1ccc(CNc2nc(S(=O)(=O)CCO)nc3c2ncn3C(C)C)cc1 |
| InChI | InChI=1S/C18H23N5O4S/c1-12(2)23-11-20-15-16(19-10-13-4-6-14(27-3)7-5-13)21-18(22-17(15)23)28(25,26)9-8-24/h4-7,11-12,24H,8-10H2,1-3H3,(H,19,21,22) |
| InChIKey | LZYVNZSYFQALQV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |