C12H11FN6 — CID 140906921
2-fluoro-9-(111C)methyl-N-(pyridin-3-ylmethyl)purin-6-amine (PubChem CID 140906921) has the molecular formula C12H11FN6 and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-fluoro-9-(111C)methyl-N-(pyridin-3-ylmethyl)purin-6-amine.
| Compound Name | 2-fluoro-9-(111C)methyl-N-(pyridin-3-ylmethyl)purin-6-amine |
|---|---|
| PubChem CID | 140906921 |
| Molecular Formula | C12H11FN6 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-fluoro-9-(111C)methyl-N-(pyridin-3-ylmethyl)purin-6-amine |
| SMILES | [11CH3]n1cnc2c(NCc3cccnc3)nc(F)nc21 |
| InChI | InChI=1S/C12H11FN6/c1-19-7-16-9-10(17-12(13)18-11(9)19)15-6-8-3-2-4-14-5-8/h2-5,7H,6H2,1H3,(H,15,17,18)/i1-1 |
| InChIKey | ODVAYBMYSUUCII-BJUDXGSMSA-N |
| XLogP | 1.51 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |