C21H33N7O — CID 142862962
1-[[9-butan-2-yl-6-(pyridin-3-ylmethylamino)purin-2-yl]amino]-2-methylpropan-2-ol;ethane (PubChem CID 142862962) has the molecular formula C21H33N7O and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-[[9-butan-2-yl-6-(pyridin-3-ylmethylamino)purin-2-yl]amino]-2-methylpropan-2-ol;ethane.
| Compound Name | 1-[[9-butan-2-yl-6-(pyridin-3-ylmethylamino)purin-2-yl]amino]-2-methylpropan-2-ol;ethane |
|---|---|
| PubChem CID | 142862962 |
| Molecular Formula | C21H33N7O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 1-[[9-butan-2-yl-6-(pyridin-3-ylmethylamino)purin-2-yl]amino]-2-methylpropan-2-ol;ethane |
| SMILES | CC.CCC(C)n1cnc2c(NCc3cccnc3)nc(NCC(C)(C)O)nc21 |
| InChI | InChI=1S/C19H27N7O.C2H6/c1-5-13(2)26-12-23-15-16(21-10-14-7-6-8-20-9-14)24-18(25-17(15)26)22-11-19(3,4)27;1-2/h6-9,12-13,27H,5,10-11H2,1-4H3,(H2,21,22,24,25);1-2H3 |
| InChIKey | JIFQTSSFNVAPNX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |