C14H17N7 — CID 117088690
9-propan-2-yl-2-N-(pyridin-3-ylmethyl)purine-2,6-diamine (PubChem CID 117088690) has the molecular formula C14H17N7 and a molecular weight of 283.34 g/mol. Its IUPAC name is 9-propan-2-yl-2-N-(pyridin-3-ylmethyl)purine-2,6-diamine.
| Compound Name | 9-propan-2-yl-2-N-(pyridin-3-ylmethyl)purine-2,6-diamine |
|---|---|
| PubChem CID | 117088690 |
| Molecular Formula | C14H17N7 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 9-propan-2-yl-2-N-(pyridin-3-ylmethyl)purine-2,6-diamine |
| SMILES | CC(C)n1cnc2c(N)nc(NCc3cccnc3)nc21 |
| InChI | InChI=1S/C14H17N7/c1-9(2)21-8-18-11-12(15)19-14(20-13(11)21)17-7-10-4-3-5-16-6-10/h3-6,8-9H,7H2,1-2H3,(H3,15,17,19,20) |
| InChIKey | VCUZSBFHPRSICQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |