C23H22N8 — CID 117084811
9-propan-2-yl-6-N-(pyridin-3-ylmethyl)-2-N-quinolin-6-ylpurine-2,6-diamine (PubChem CID 117084811) has the molecular formula C23H22N8 and a molecular weight of 410.49 g/mol. Its IUPAC name is 9-propan-2-yl-6-N-(pyridin-3-ylmethyl)-2-N-quinolin-6-ylpurine-2,6-diamine.
| Compound Name | 9-propan-2-yl-6-N-(pyridin-3-ylmethyl)-2-N-quinolin-6-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117084811 |
| Molecular Formula | C23H22N8 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 9-propan-2-yl-6-N-(pyridin-3-ylmethyl)-2-N-quinolin-6-ylpurine-2,6-diamine |
| SMILES | CC(C)n1cnc2c(NCc3cccnc3)nc(Nc3ccc4ncccc4c3)nc21 |
| InChI | InChI=1S/C23H22N8/c1-15(2)31-14-27-20-21(26-13-16-5-3-9-24-12-16)29-23(30-22(20)31)28-18-7-8-19-17(11-18)6-4-10-25-19/h3-12,14-15H,13H2,1-2H3,(H2,26,28,29,30) |
| InChIKey | CPVSGXJTKUZCDR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |