C21H17N9 — CID 117080067
9-phenyl-6-N-(pyridin-3-ylmethyl)-2-N-pyrimidin-2-ylpurine-2,6-diamine (PubChem CID 117080067) has the molecular formula C21H17N9 and a molecular weight of 395.43 g/mol. Its IUPAC name is 9-phenyl-6-N-(pyridin-3-ylmethyl)-2-N-pyrimidin-2-ylpurine-2,6-diamine.
| Compound Name | 9-phenyl-6-N-(pyridin-3-ylmethyl)-2-N-pyrimidin-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117080067 |
| Molecular Formula | C21H17N9 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 9-phenyl-6-N-(pyridin-3-ylmethyl)-2-N-pyrimidin-2-ylpurine-2,6-diamine |
| SMILES | c1ccc(-n2cnc3c(NCc4cccnc4)nc(Nc4ncccn4)nc32)cc1 |
| InChI | InChI=1S/C21H17N9/c1-2-7-16(8-3-1)30-14-26-17-18(25-13-15-6-4-9-22-12-15)27-21(28-19(17)30)29-20-23-10-5-11-24-20/h1-12,14H,13H2,(H2,23,24,25,27,28,29) |
| InChIKey | AMYJEIWACRXACV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |