C24H26N8O — CID 117092103
1-[3-[[9-phenyl-2-(pyridin-3-ylmethylamino)purin-6-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117092103) has the molecular formula C24H26N8O and a molecular weight of 442.53 g/mol. Its IUPAC name is 1-[3-[[9-phenyl-2-(pyridin-3-ylmethylamino)purin-6-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[9-phenyl-2-(pyridin-3-ylmethylamino)purin-6-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117092103 |
| Molecular Formula | C24H26N8O |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 1-[3-[[9-phenyl-2-(pyridin-3-ylmethylamino)purin-6-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNc1nc(NCc2cccnc2)nc2c1ncn2-c1ccccc1 |
| InChI | InChI=1S/C24H26N8O/c33-20-10-5-13-31(20)14-6-12-26-22-21-23(32(17-28-21)19-8-2-1-3-9-19)30-24(29-22)27-16-18-7-4-11-25-15-18/h1-4,7-9,11,15,17H,5-6,10,12-14,16H2,(H2,26,27,29,30) |
| InChIKey | DCXOZRYXNAFTNM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|