C22H29N9O — CID 117085284
1-[3-[[9-cyclohexyl-2-(pyrazin-2-ylamino)purin-6-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117085284) has the molecular formula C22H29N9O and a molecular weight of 435.54 g/mol. Its IUPAC name is 1-[3-[[9-cyclohexyl-2-(pyrazin-2-ylamino)purin-6-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[9-cyclohexyl-2-(pyrazin-2-ylamino)purin-6-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117085284 |
| Molecular Formula | C22H29N9O |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 1-[3-[[9-cyclohexyl-2-(pyrazin-2-ylamino)purin-6-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNc1nc(Nc2cnccn2)nc2c1ncn2C1CCCCC1 |
| InChI | InChI=1S/C22H29N9O/c32-18-8-4-12-30(18)13-5-9-25-20-19-21(31(15-26-19)16-6-2-1-3-7-16)29-22(28-20)27-17-14-23-10-11-24-17/h10-11,14-16H,1-9,12-13H2,(H2,24,25,27,28,29) |
| InChIKey | LQMJLWQCMKCFRZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|