C25H25N9OS — CID 117080874
1-[3-[[2-(4-imidazol-1-ylanilino)-9-thiophen-3-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117080874) has the molecular formula C25H25N9OS and a molecular weight of 499.60 g/mol. Its IUPAC name is 1-[3-[[2-(4-imidazol-1-ylanilino)-9-thiophen-3-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-(4-imidazol-1-ylanilino)-9-thiophen-3-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117080874 |
| Molecular Formula | C25H25N9OS |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 1-[3-[[2-(4-imidazol-1-ylanilino)-9-thiophen-3-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNc1nc(Nc2ccc(-n3ccnc3)cc2)nc2c1ncn2-c1ccsc1 |
| InChI | InChI=1S/C25H25N9OS/c35-21-3-1-11-32(21)12-2-9-27-23-22-24(34(17-28-22)20-8-14-36-15-20)31-25(30-23)29-18-4-6-19(7-5-18)33-13-10-26-16-33/h4-8,10,13-17H,1-3,9,11-12H2,(H2,27,29,30,31) |
| InChIKey | FEXQMSMDHIDQOG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|