C20H26N8O — CID 117090692
1-[3-[[9-propan-2-yl-2-(pyridin-4-ylamino)purin-6-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117090692) has the molecular formula C20H26N8O and a molecular weight of 394.48 g/mol. Its IUPAC name is 1-[3-[[9-propan-2-yl-2-(pyridin-4-ylamino)purin-6-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[9-propan-2-yl-2-(pyridin-4-ylamino)purin-6-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117090692 |
| Molecular Formula | C20H26N8O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1-[3-[[9-propan-2-yl-2-(pyridin-4-ylamino)purin-6-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | CC(C)n1cnc2c(NCCCN3CCCC3=O)nc(Nc3ccncc3)nc21 |
| InChI | InChI=1S/C20H26N8O/c1-14(2)28-13-23-17-18(22-8-4-12-27-11-3-5-16(27)29)25-20(26-19(17)28)24-15-6-9-21-10-7-15/h6-7,9-10,13-14H,3-5,8,11-12H2,1-2H3,(H2,21,22,24,25,26) |
| InChIKey | AHKXDPNNCSATPC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|