C20H21N9OS — CID 117081849
1-[3-[[2-(pyrimidin-4-ylamino)-9-thiophen-3-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117081849) has the molecular formula C20H21N9OS and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-[3-[[2-(pyrimidin-4-ylamino)-9-thiophen-3-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-(pyrimidin-4-ylamino)-9-thiophen-3-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117081849 |
| Molecular Formula | C20H21N9OS |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 1-[3-[[2-(pyrimidin-4-ylamino)-9-thiophen-3-ylpurin-6-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNc1nc(Nc2ccncn2)nc2c1ncn2-c1ccsc1 |
| InChI | InChI=1S/C20H21N9OS/c30-16-3-1-8-28(16)9-2-6-22-18-17-19(29(13-24-17)14-5-10-31-11-14)27-20(26-18)25-15-4-7-21-12-23-15/h4-5,7,10-13H,1-3,6,8-9H2,(H2,21,22,23,25,26,27) |
| InChIKey | OUQZRBNNIWCOCG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|