C24H36N8OS — CID 117080093
1-[3-[[6-[2-[di(propan-2-yl)amino]ethylamino]-9-thiophen-3-ylpurin-2-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117080093) has the molecular formula C24H36N8OS and a molecular weight of 484.67 g/mol. Its IUPAC name is 1-[3-[[6-[2-[di(propan-2-yl)amino]ethylamino]-9-thiophen-3-ylpurin-2-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[6-[2-[di(propan-2-yl)amino]ethylamino]-9-thiophen-3-ylpurin-2-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117080093 |
| Molecular Formula | C24H36N8OS |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 1-[3-[[6-[2-[di(propan-2-yl)amino]ethylamino]-9-thiophen-3-ylpurin-2-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | CC(C)N(CCNc1nc(NCCCN2CCCC2=O)nc2c1ncn2-c1ccsc1)C(C)C |
| InChI | InChI=1S/C24H36N8OS/c1-17(2)31(18(3)4)13-10-25-22-21-23(32(16-27-21)19-8-14-34-15-19)29-24(28-22)26-9-6-12-30-11-5-7-20(30)33/h8,14-18H,5-7,9-13H2,1-4H3,(H2,25,26,28,29) |
| InChIKey | AISCHRUGDLMYPG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|