C20H34N8O — CID 117078992
1-[3-[[6-[2-[di(propan-2-yl)amino]ethylamino]-7H-purin-2-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117078992) has the molecular formula C20H34N8O and a molecular weight of 402.55 g/mol. Its IUPAC name is 1-[3-[[6-[2-[di(propan-2-yl)amino]ethylamino]-7H-purin-2-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[6-[2-[di(propan-2-yl)amino]ethylamino]-7H-purin-2-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117078992 |
| Molecular Formula | C20H34N8O |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | 1-[3-[[6-[2-[di(propan-2-yl)amino]ethylamino]-7H-purin-2-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | CC(C)N(CCNc1nc(NCCCN2CCCC2=O)nc2nc[nH]c12)C(C)C |
| InChI | InChI=1S/C20H34N8O/c1-14(2)28(15(3)4)12-9-21-18-17-19(24-13-23-17)26-20(25-18)22-8-6-11-27-10-5-7-16(27)29/h13-15H,5-12H2,1-4H3,(H3,21,22,23,24,25,26) |
| InChIKey | UAAPDVXGFPLAHV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|