C26H40Cl2N10O2 — CID 21081039
1-[3-[[2-chloro-5-(dimethylamino)pyrimidin-4-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 21081039) has the molecular formula C26H40Cl2N10O2 and a molecular weight of 595.58 g/mol. Its IUPAC name is 1-[3-[[2-chloro-5-(dimethylamino)pyrimidin-4-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-chloro-5-(dimethylamino)pyrimidin-4-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 21081039 |
| Molecular Formula | C26H40Cl2N10O2 |
| Molecular Weight | 595.58 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 1-[3-[[2-chloro-5-(dimethylamino)pyrimidin-4-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | CN(C)c1cnc(Cl)nc1NCCCN1CCCC1=O.CN(C)c1cnc(Cl)nc1NCCCN1CCCC1=O |
| InChI | InChI=1S/2C13H20ClN5O/c2*1-18(2)10-9-16-13(14)17-12(10)15-6-4-8-19-7-3-5-11(19)20/h2*9H,3-8H2,1-2H3,(H,15,16,17) |
| InChIKey | OBJCDWCNUDHRMH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|