C14H17ClF3N3O — CID 155269866
1-[3-[[2-chloro-5-(trifluoromethyl)-4-pyridinyl]amino]propyl]piperidin-2-one (PubChem CID 155269866) has the molecular formula C14H17ClF3N3O and a molecular weight of 335.76 g/mol. Its IUPAC name is 1-[3-[[2-chloro-5-(trifluoromethyl)-4-pyridinyl]amino]propyl]piperidin-2-one.
| Compound Name | 1-[3-[[2-chloro-5-(trifluoromethyl)-4-pyridinyl]amino]propyl]piperidin-2-one |
|---|---|
| PubChem CID | 155269866 |
| Molecular Formula | C14H17ClF3N3O |
| Molecular Weight | 335.76 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-[3-[[2-chloro-5-(trifluoromethyl)-4-pyridinyl]amino]propyl]piperidin-2-one |
| SMILES | O=C1CCCCN1CCCNc1cc(Cl)ncc1C(F)(F)F |
| InChI | InChI=1S/C14H17ClF3N3O/c15-12-8-11(10(9-20-12)14(16,17)18)19-5-3-7-21-6-2-1-4-13(21)22/h8-9H,1-7H2,(H,19,20) |
| InChIKey | XLJOMDKUNPLXPV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|