C15H17ClF4N2O — CID 10861134
1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one (PubChem CID 10861134) has the molecular formula C15H17ClF4N2O and a molecular weight of 352.76 g/mol. Its IUPAC name is 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one.
| Compound Name | 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one |
|---|---|
| PubChem CID | 10861134 |
| Molecular Formula | C15H17ClF4N2O |
| Molecular Weight | 352.76 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one |
| SMILES | O=C1CCCCCN1CCCNc1c(F)c(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C15H17ClF4N2O/c16-10-11(17)13(19)15(14(20)12(10)18)21-6-4-8-22-7-3-1-2-5-9(22)23/h21H,1-8H2 |
| InChIKey | IGQIWLZWUCIXFT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|