About 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one
1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one (PubChem CID 10861134) has the molecular formula C15H17ClF4N2O
and a molecular weight of 352.76 g/mol. Its IUPAC name is 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one.
Molecular Properties
| Compound Name | 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one |
| PubChem CID | 10861134 |
| Molecular Formula | C15H17ClF4N2O |
| Molecular Weight | 352.76 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one |
| SMILES | O=C1CCCCCN1CCCNc1c(F)c(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C15H17ClF4N2O/c16-10-11(17)13(19)15(14(20)12(10)18)21-6-4-8-22-7-3-1-2-5-9(22)23/h21H,1-8H2 |
| InChIKey | IGQIWLZWUCIXFT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one?
The IUPAC name of 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one (CID 10861134) is 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one.
What is the SMILES notation for 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one?
The canonical SMILES for 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one is O=C1CCCCCN1CCCNc1c(F)c(F)c(Cl)c(F)c1F.
What is the InChIKey of 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one?
The InChIKey is IGQIWLZWUCIXFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClF4N2O/c16-10-11(17)13(19)15(14(20)12(10)18)21-6-4-8-22-7-3-1-2-5-9(22)23/h21H,1-8H2.
What are the key properties of 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one?
1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one has a molecular weight of 352.76 g/mol, XLogP of 4.10, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-chloro-2,3,5,6-tetrafluoroanilino)propyl]azepan-2-one is sourced from PubChem (CID 10861134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).