C16H19F2N3O — CID 60602627
3,5-difluoro-4-[3-(2-oxoazepan-1-yl)propylamino]benzonitrile (PubChem CID 60602627) has the molecular formula C16H19F2N3O and a molecular weight of 307.34 g/mol. Its IUPAC name is 3,5-difluoro-4-[3-(2-oxoazepan-1-yl)propylamino]benzonitrile.
| Compound Name | 3,5-difluoro-4-[3-(2-oxoazepan-1-yl)propylamino]benzonitrile |
|---|---|
| PubChem CID | 60602627 |
| Molecular Formula | C16H19F2N3O |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3,5-difluoro-4-[3-(2-oxoazepan-1-yl)propylamino]benzonitrile |
| SMILES | N#Cc1cc(F)c(NCCCN2CCCCCC2=O)c(F)c1 |
| InChI | InChI=1S/C16H19F2N3O/c17-13-9-12(11-19)10-14(18)16(13)20-6-4-8-21-7-3-1-2-5-15(21)22/h9-10,20H,1-8H2 |
| InChIKey | AGSZBYMPVVJJSX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|