C13H15ClF3N3O2 — CID 155280231
3-[3-[[2-chloro-5-(trifluoromethyl)-4-pyridinyl]amino]propyl]-1,3-oxazinan-2-one (PubChem CID 155280231) has the molecular formula C13H15ClF3N3O2 and a molecular weight of 337.73 g/mol. Its IUPAC name is 3-[3-[[2-chloro-5-(trifluoromethyl)-4-pyridinyl]amino]propyl]-1,3-oxazinan-2-one.
| Compound Name | 3-[3-[[2-chloro-5-(trifluoromethyl)-4-pyridinyl]amino]propyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 155280231 |
| Molecular Formula | C13H15ClF3N3O2 |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3-[3-[[2-chloro-5-(trifluoromethyl)-4-pyridinyl]amino]propyl]-1,3-oxazinan-2-one |
| SMILES | O=C1OCCCN1CCCNc1cc(Cl)ncc1C(F)(F)F |
| InChI | InChI=1S/C13H15ClF3N3O2/c14-11-7-10(9(8-19-11)13(15,16)17)18-3-1-4-20-5-2-6-22-12(20)21/h7-8H,1-6H2,(H,18,19) |
| InChIKey | XOYFDXVJDLMLEJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|