C20H24F3N5O2 — CID 174335076
1-[3-[[2-(2-methoxyanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]piperidin-2-one (PubChem CID 174335076) has the molecular formula C20H24F3N5O2 and a molecular weight of 423.44 g/mol. Its IUPAC name is 1-[3-[[2-(2-methoxyanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]piperidin-2-one.
| Compound Name | 1-[3-[[2-(2-methoxyanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]piperidin-2-one |
|---|---|
| PubChem CID | 174335076 |
| Molecular Formula | C20H24F3N5O2 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1-[3-[[2-(2-methoxyanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]piperidin-2-one |
| SMILES | COc1ccccc1Nc1ncc(C(F)(F)F)c(NCCCN2CCCCC2=O)n1 |
| InChI | InChI=1S/C20H24F3N5O2/c1-30-16-8-3-2-7-15(16)26-19-25-13-14(20(21,22)23)18(27-19)24-10-6-12-28-11-5-4-9-17(28)29/h2-3,7-8,13H,4-6,9-12H2,1H3,(H2,24,25,26,27) |
| InChIKey | LWBMVIBUGOQRQW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|