C20H30F3N5O — CID 155722344
1-[3-[[2-[[(E)-hept-3-en-4-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]piperidin-2-one (PubChem CID 155722344) has the molecular formula C20H30F3N5O and a molecular weight of 413.49 g/mol. Its IUPAC name is 1-[3-[[2-[[(E)-hept-3-en-4-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]piperidin-2-one.
| Compound Name | 1-[3-[[2-[[(E)-hept-3-en-4-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]piperidin-2-one |
|---|---|
| PubChem CID | 155722344 |
| Molecular Formula | C20H30F3N5O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 1-[3-[[2-[[(E)-hept-3-en-4-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]piperidin-2-one |
| SMILES | CC/C=C(\CCC)Nc1ncc(C(F)(F)F)c(NCCCN2CCCCC2=O)n1 |
| InChI | InChI=1S/C20H30F3N5O/c1-3-8-15(9-4-2)26-19-25-14-16(20(21,22)23)18(27-19)24-11-7-13-28-12-6-5-10-17(28)29/h8,14H,3-7,9-13H2,1-2H3,(H2,24,25,26,27)/b15-8+ |
| InChIKey | ZWLHPVUKDPLVAH-OVCLIPMQSA-N |
| XLogP | 4.82 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|