C16H22F3N5O2 — CID 155722117
4-[3-[[2-(prop-1-en-2-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one (PubChem CID 155722117) has the molecular formula C16H22F3N5O2 and a molecular weight of 373.38 g/mol. Its IUPAC name is 4-[3-[[2-(prop-1-en-2-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one.
| Compound Name | 4-[3-[[2-(prop-1-en-2-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 155722117 |
| Molecular Formula | C16H22F3N5O2 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 4-[3-[[2-(prop-1-en-2-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one |
| SMILES | C=C(C)Nc1ncc(C(F)(F)F)c(NCCCN2CCOCCC2=O)n1 |
| InChI | InChI=1S/C16H22F3N5O2/c1-11(2)22-15-21-10-12(16(17,18)19)14(23-15)20-5-3-6-24-7-9-26-8-4-13(24)25/h10H,1,3-9H2,2H3,(H2,20,21,22,23) |
| InChIKey | NCTBTNCEOSGRHZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|