C18H24F3N5O2 — CID 177204390
4-[3-[[2-(1-bicyclo[1.1.1]pentanylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one (PubChem CID 177204390) has the molecular formula C18H24F3N5O2 and a molecular weight of 399.42 g/mol. Its IUPAC name is 4-[3-[[2-(1-bicyclo[1.1.1]pentanylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one.
| Compound Name | 4-[3-[[2-(1-bicyclo[1.1.1]pentanylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 177204390 |
| Molecular Formula | C18H24F3N5O2 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 4-[3-[[2-(1-bicyclo[1.1.1]pentanylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one |
| SMILES | O=C1CCOCCN1CCCNc1nc(NC23CC(C2)C3)ncc1C(F)(F)F |
| InChI | InChI=1S/C18H24F3N5O2/c19-18(20,21)13-11-23-16(25-17-8-12(9-17)10-17)24-15(13)22-3-1-4-26-5-7-28-6-2-14(26)27/h11-12H,1-10H2,(H2,22,23,24,25) |
| InChIKey | XHYNZSSFGSTDIA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|