C26H33F3N6O3 — CID 175591067
4-[3-[[2-(2-cyclopropyl-4-morpholin-2-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one (PubChem CID 175591067) has the molecular formula C26H33F3N6O3 and a molecular weight of 534.58 g/mol. Its IUPAC name is 4-[3-[[2-(2-cyclopropyl-4-morpholin-2-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one.
| Compound Name | 4-[3-[[2-(2-cyclopropyl-4-morpholin-2-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 175591067 |
| Molecular Formula | C26H33F3N6O3 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 4-[3-[[2-(2-cyclopropyl-4-morpholin-2-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one |
| SMILES | O=C1CCOCCN1CCCNc1nc(Nc2ccc(C3CNCCO3)cc2C2CC2)ncc1C(F)(F)F |
| InChI | InChI=1S/C26H33F3N6O3/c27-26(28,29)20-15-32-25(34-24(20)31-7-1-9-35-10-13-37-11-6-23(35)36)33-21-5-4-18(14-19(21)17-2-3-17)22-16-30-8-12-38-22/h4-5,14-15,17,22,30H,1-3,6-13,16H2,(H2,31,32,33,34) |
| InChIKey | GLHYNDRRKSGWTA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|