C20H23N9O — CID 117081234
1-[3-[[2-[(1-methylbenzimidazol-2-yl)amino]-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117081234) has the molecular formula C20H23N9O and a molecular weight of 405.47 g/mol. Its IUPAC name is 1-[3-[[2-[(1-methylbenzimidazol-2-yl)amino]-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-[(1-methylbenzimidazol-2-yl)amino]-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117081234 |
| Molecular Formula | C20H23N9O |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 1-[3-[[2-[(1-methylbenzimidazol-2-yl)amino]-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | Cn1c(Nc2nc(NCCCN3CCCC3=O)c3[nH]cnc3n2)nc2ccccc21 |
| InChI | InChI=1S/C20H23N9O/c1-28-14-7-3-2-6-13(14)24-20(28)27-19-25-17(16-18(26-19)23-12-22-16)21-9-5-11-29-10-4-8-15(29)30/h2-3,6-7,12H,4-5,8-11H2,1H3,(H3,21,22,23,24,25,26,27) |
| InChIKey | XSUZIPGHUWLUSO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|