C18H21N7O — CID 117091724
1-[3-[(8-anilino-7H-purin-6-yl)amino]propyl]pyrrolidin-2-one (PubChem CID 117091724) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-[3-[(8-anilino-7H-purin-6-yl)amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(8-anilino-7H-purin-6-yl)amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117091724 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-[3-[(8-anilino-7H-purin-6-yl)amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNc1ncnc2nc(Nc3ccccc3)[nH]c12 |
| InChI | InChI=1S/C18H21N7O/c26-14-8-4-10-25(14)11-5-9-19-16-15-17(21-12-20-16)24-18(23-15)22-13-6-2-1-3-7-13/h1-3,6-7,12H,4-5,8-11H2,(H3,19,20,21,22,23,24) |
| InChIKey | HOQAEPKPIUPFDK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|