C21H22N8O — CID 117084800
1-[3-[[8-(quinolin-6-ylamino)-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117084800) has the molecular formula C21H22N8O and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-[3-[[8-(quinolin-6-ylamino)-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[8-(quinolin-6-ylamino)-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117084800 |
| Molecular Formula | C21H22N8O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-[3-[[8-(quinolin-6-ylamino)-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNc1ncnc2nc(Nc3ccc4ncccc4c3)[nH]c12 |
| InChI | InChI=1S/C21H22N8O/c30-17-5-2-10-29(17)11-3-9-23-19-18-20(25-13-24-19)28-21(27-18)26-15-6-7-16-14(12-15)4-1-8-22-16/h1,4,6-8,12-13H,2-3,5,9-11H2,(H3,23,24,25,26,27,28) |
| InChIKey | QQAGWLDMFOZJMT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|