C16H19N9O — CID 117080695
1-[3-[[2-(pyrimidin-2-ylamino)-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117080695) has the molecular formula C16H19N9O and a molecular weight of 353.39 g/mol. Its IUPAC name is 1-[3-[[2-(pyrimidin-2-ylamino)-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-(pyrimidin-2-ylamino)-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117080695 |
| Molecular Formula | C16H19N9O |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-[3-[[2-(pyrimidin-2-ylamino)-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNc1nc(Nc2ncccn2)nc2nc[nH]c12 |
| InChI | InChI=1S/C16H19N9O/c26-11-4-1-8-25(11)9-3-7-17-13-12-14(21-10-20-12)23-16(22-13)24-15-18-5-2-6-19-15/h2,5-6,10H,1,3-4,7-9H2,(H3,17,18,19,20,21,22,23,24) |
| InChIKey | KZWJPKKVSMFAPU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|