C21H24N6O3S — CID 10365970
1-[3-[[3-[3-(4-methylsulfonylphenyl)-1H-1,2,4-triazol-5-yl]-2-pyridinyl]amino]propyl]pyrrolidin-2-one (PubChem CID 10365970) has the molecular formula C21H24N6O3S and a molecular weight of 440.53 g/mol. Its IUPAC name is 1-[3-[[3-[3-(4-methylsulfonylphenyl)-1H-1,2,4-triazol-5-yl]-2-pyridinyl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[3-[3-(4-methylsulfonylphenyl)-1H-1,2,4-triazol-5-yl]-2-pyridinyl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 10365970 |
| Molecular Formula | C21H24N6O3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1-[3-[[3-[3-(4-methylsulfonylphenyl)-1H-1,2,4-triazol-5-yl]-2-pyridinyl]amino]propyl]pyrrolidin-2-one |
| SMILES | CS(=O)(=O)c1ccc(-c2n[nH]c(-c3cccnc3NCCCN3CCCC3=O)n2)cc1 |
| InChI | InChI=1S/C21H24N6O3S/c1-31(29,30)16-9-7-15(8-10-16)19-24-21(26-25-19)17-5-2-11-22-20(17)23-12-4-14-27-13-3-6-18(27)28/h2,5,7-11H,3-4,6,12-14H2,1H3,(H,22,23)(H,24,25,26) |
| InChIKey | CHIFURWSLRAUJN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|