C15H19N7O — CID 117091420
1-[3-[[2-(pyrimidin-2-ylamino)pyrimidin-4-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117091420) has the molecular formula C15H19N7O and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-[3-[[2-(pyrimidin-2-ylamino)pyrimidin-4-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-(pyrimidin-2-ylamino)pyrimidin-4-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117091420 |
| Molecular Formula | C15H19N7O |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-[3-[[2-(pyrimidin-2-ylamino)pyrimidin-4-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCNc1ccnc(Nc2ncccn2)n1 |
| InChI | InChI=1S/C15H19N7O/c23-13-4-1-10-22(13)11-3-8-16-12-5-9-19-15(20-12)21-14-17-6-2-7-18-14/h2,5-7,9H,1,3-4,8,10-11H2,(H2,16,17,18,19,20,21) |
| InChIKey | JPAJLHANTHOBAH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|