C23H21N7O — CID 117088681
6-N-[2-(4-methoxyphenyl)ethyl]-8-N-quinolin-6-yl-7H-purine-6,8-diamine (PubChem CID 117088681) has the molecular formula C23H21N7O and a molecular weight of 411.47 g/mol. Its IUPAC name is 6-N-[2-(4-methoxyphenyl)ethyl]-8-N-quinolin-6-yl-7H-purine-6,8-diamine.
| Compound Name | 6-N-[2-(4-methoxyphenyl)ethyl]-8-N-quinolin-6-yl-7H-purine-6,8-diamine |
|---|---|
| PubChem CID | 117088681 |
| Molecular Formula | C23H21N7O |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 6-N-[2-(4-methoxyphenyl)ethyl]-8-N-quinolin-6-yl-7H-purine-6,8-diamine |
| SMILES | COc1ccc(CCNc2ncnc3nc(Nc4ccc5ncccc5c4)[nH]c23)cc1 |
| InChI | InChI=1S/C23H21N7O/c1-31-18-7-4-15(5-8-18)10-12-25-21-20-22(27-14-26-21)30-23(29-20)28-17-6-9-19-16(13-17)3-2-11-24-19/h2-9,11,13-14H,10,12H2,1H3,(H3,25,26,27,28,29,30) |
| InChIKey | VOCXNPZRWADJQA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |