C18H18N2O2 — CID 165347661
N-[(3,5-dimethoxyphenyl)methyl]quinolin-6-amine (PubChem CID 165347661) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]quinolin-6-amine.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]quinolin-6-amine |
|---|---|
| PubChem CID | 165347661 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]quinolin-6-amine |
| SMILES | COc1cc(CNc2ccc3ncccc3c2)cc(OC)c1 |
| InChI | InChI=1S/C18H18N2O2/c1-21-16-8-13(9-17(11-16)22-2)12-20-15-5-6-18-14(10-15)4-3-7-19-18/h3-11,20H,12H2,1-2H3 |
| InChIKey | DLQOSZDDSXSFIJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |