C17H19N3O2 — CID 59778805
N-[(3,5-dimethoxyphenyl)methyl]-2-methylindazol-5-amine (PubChem CID 59778805) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-2-methylindazol-5-amine.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-2-methylindazol-5-amine |
|---|---|
| PubChem CID | 59778805 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-2-methylindazol-5-amine |
| SMILES | COc1cc(CNc2ccc3nn(C)cc3c2)cc(OC)c1 |
| InChI | InChI=1S/C17H19N3O2/c1-20-11-13-8-14(4-5-17(13)19-20)18-10-12-6-15(21-2)9-16(7-12)22-3/h4-9,11,18H,10H2,1-3H3 |
| InChIKey | FEGUXONDDLFQSD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |