C23H28F3N7O — CID 117088721
1-[3-[[9-propan-2-yl-6-[[3-(trifluoromethyl)phenyl]methylamino]purin-2-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117088721) has the molecular formula C23H28F3N7O and a molecular weight of 475.52 g/mol. Its IUPAC name is 1-[3-[[9-propan-2-yl-6-[[3-(trifluoromethyl)phenyl]methylamino]purin-2-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[9-propan-2-yl-6-[[3-(trifluoromethyl)phenyl]methylamino]purin-2-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117088721 |
| Molecular Formula | C23H28F3N7O |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 1-[3-[[9-propan-2-yl-6-[[3-(trifluoromethyl)phenyl]methylamino]purin-2-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | CC(C)n1cnc2c(NCc3cccc(C(F)(F)F)c3)nc(NCCCN3CCCC3=O)nc21 |
| InChI | InChI=1S/C23H28F3N7O/c1-15(2)33-14-29-19-20(28-13-16-6-3-7-17(12-16)23(24,25)26)30-22(31-21(19)33)27-9-5-11-32-10-4-8-18(32)34/h3,6-7,12,14-15H,4-5,8-11,13H2,1-2H3,(H2,27,28,30,31) |
| InChIKey | LMOJIBPYIWMLDR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|