C21H31N7 — CID 117091747
6-N-[2-[di(propan-2-yl)amino]ethyl]-2-N-ethyl-9-phenylpurine-2,6-diamine (PubChem CID 117091747) has the molecular formula C21H31N7 and a molecular weight of 381.53 g/mol. Its IUPAC name is 6-N-[2-[di(propan-2-yl)amino]ethyl]-2-N-ethyl-9-phenylpurine-2,6-diamine.
| Compound Name | 6-N-[2-[di(propan-2-yl)amino]ethyl]-2-N-ethyl-9-phenylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117091747 |
| Molecular Formula | C21H31N7 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | 6-N-[2-[di(propan-2-yl)amino]ethyl]-2-N-ethyl-9-phenylpurine-2,6-diamine |
| SMILES | CCNc1nc(NCCN(C(C)C)C(C)C)c2ncn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C21H31N7/c1-6-22-21-25-19(23-12-13-27(15(2)3)16(4)5)18-20(26-21)28(14-24-18)17-10-8-7-9-11-17/h7-11,14-16H,6,12-13H2,1-5H3,(H2,22,23,25,26) |
| InChIKey | KLSJLVCJIZZWDI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |