C18H18N8 — CID 117080414
9-phenyl-6-N-propyl-2-N-pyrimidin-2-ylpurine-2,6-diamine (PubChem CID 117080414) has the molecular formula C18H18N8 and a molecular weight of 346.40 g/mol. Its IUPAC name is 9-phenyl-6-N-propyl-2-N-pyrimidin-2-ylpurine-2,6-diamine.
| Compound Name | 9-phenyl-6-N-propyl-2-N-pyrimidin-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117080414 |
| Molecular Formula | C18H18N8 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 9-phenyl-6-N-propyl-2-N-pyrimidin-2-ylpurine-2,6-diamine |
| SMILES | CCCNc1nc(Nc2ncccn2)nc2c1ncn2-c1ccccc1 |
| InChI | InChI=1S/C18H18N8/c1-2-9-19-15-14-16(26(12-22-14)13-7-4-3-5-8-13)24-18(23-15)25-17-20-10-6-11-21-17/h3-8,10-12H,2,9H2,1H3,(H2,19,20,21,23,24,25) |
| InChIKey | SFAUSGHNVXXSGA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |