C23H19N7 — CID 117083688
6-N-benzyl-9-phenyl-2-N-pyridin-3-ylpurine-2,6-diamine (PubChem CID 117083688) has the molecular formula C23H19N7 and a molecular weight of 393.45 g/mol. Its IUPAC name is 6-N-benzyl-9-phenyl-2-N-pyridin-3-ylpurine-2,6-diamine.
| Compound Name | 6-N-benzyl-9-phenyl-2-N-pyridin-3-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117083688 |
| Molecular Formula | C23H19N7 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 6-N-benzyl-9-phenyl-2-N-pyridin-3-ylpurine-2,6-diamine |
| SMILES | c1ccc(CNc2nc(Nc3cccnc3)nc3c2ncn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N7/c1-3-8-17(9-4-1)14-25-21-20-22(30(16-26-20)19-11-5-2-6-12-19)29-23(28-21)27-18-10-7-13-24-15-18/h1-13,15-16H,14H2,(H2,25,27,28,29) |
| InChIKey | VUCBRNDIBCHHNX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |