C22H24N8 — CID 117093752
6-N-benzyl-9-cyclohexyl-2-N-pyrazin-2-ylpurine-2,6-diamine (PubChem CID 117093752) has the molecular formula C22H24N8 and a molecular weight of 400.49 g/mol. Its IUPAC name is 6-N-benzyl-9-cyclohexyl-2-N-pyrazin-2-ylpurine-2,6-diamine.
| Compound Name | 6-N-benzyl-9-cyclohexyl-2-N-pyrazin-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117093752 |
| Molecular Formula | C22H24N8 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 6-N-benzyl-9-cyclohexyl-2-N-pyrazin-2-ylpurine-2,6-diamine |
| SMILES | c1ccc(CNc2nc(Nc3cnccn3)nc3c2ncn3C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H24N8/c1-3-7-16(8-4-1)13-25-20-19-21(30(15-26-19)17-9-5-2-6-10-17)29-22(28-20)27-18-14-23-11-12-24-18/h1,3-4,7-8,11-12,14-15,17H,2,5-6,9-10,13H2,(H2,24,25,27,28,29) |
| InChIKey | LTLROKYZGUJHNN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |