C24H25N9 — CID 117085764
6-N-(1H-benzimidazol-2-ylmethyl)-9-cyclohexyl-2-N-pyridin-4-ylpurine-2,6-diamine (PubChem CID 117085764) has the molecular formula C24H25N9 and a molecular weight of 439.53 g/mol. Its IUPAC name is 6-N-(1H-benzimidazol-2-ylmethyl)-9-cyclohexyl-2-N-pyridin-4-ylpurine-2,6-diamine.
| Compound Name | 6-N-(1H-benzimidazol-2-ylmethyl)-9-cyclohexyl-2-N-pyridin-4-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117085764 |
| Molecular Formula | C24H25N9 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 6-N-(1H-benzimidazol-2-ylmethyl)-9-cyclohexyl-2-N-pyridin-4-ylpurine-2,6-diamine |
| SMILES | c1ccc2[nH]c(CNc3nc(Nc4ccncc4)nc4c3ncn4C3CCCCC3)nc2c1 |
| InChI | InChI=1S/C24H25N9/c1-2-6-17(7-3-1)33-15-27-21-22(26-14-20-29-18-8-4-5-9-19(18)30-20)31-24(32-23(21)33)28-16-10-12-25-13-11-16/h4-5,8-13,15,17H,1-3,6-7,14H2,(H,29,30)(H2,25,26,28,31,32) |
| InChIKey | MQUGHFLCILIDKK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |