C23H26N8O — CID 130229634
2-[6-(1H-benzimidazol-2-ylmethylamino)-2-pyrrolidin-1-ylpurin-9-yl]cyclohexan-1-one (PubChem CID 130229634) has the molecular formula C23H26N8O and a molecular weight of 430.52 g/mol. Its IUPAC name is 2-[6-(1H-benzimidazol-2-ylmethylamino)-2-pyrrolidin-1-ylpurin-9-yl]cyclohexan-1-one.
| Compound Name | 2-[6-(1H-benzimidazol-2-ylmethylamino)-2-pyrrolidin-1-ylpurin-9-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 130229634 |
| Molecular Formula | C23H26N8O |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 2-[6-(1H-benzimidazol-2-ylmethylamino)-2-pyrrolidin-1-ylpurin-9-yl]cyclohexan-1-one |
| SMILES | O=C1CCCCC1n1cnc2c(NCc3nc4ccccc4[nH]3)nc(N3CCCC3)nc21 |
| InChI | InChI=1S/C23H26N8O/c32-18-10-4-3-9-17(18)31-14-25-20-21(28-23(29-22(20)31)30-11-5-6-12-30)24-13-19-26-15-7-1-2-8-16(15)27-19/h1-2,7-8,14,17H,3-6,9-13H2,(H,26,27)(H,24,28,29) |
| InChIKey | VLUQMGIOVJEUBY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |