C23H24N10 — CID 117089912
6-N-(1H-benzimidazol-2-ylmethyl)-9-cyclohexyl-2-N-pyrazin-2-ylpurine-2,6-diamine (PubChem CID 117089912) has the molecular formula C23H24N10 and a molecular weight of 440.52 g/mol. Its IUPAC name is 6-N-(1H-benzimidazol-2-ylmethyl)-9-cyclohexyl-2-N-pyrazin-2-ylpurine-2,6-diamine.
| Compound Name | 6-N-(1H-benzimidazol-2-ylmethyl)-9-cyclohexyl-2-N-pyrazin-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117089912 |
| Molecular Formula | C23H24N10 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 6-N-(1H-benzimidazol-2-ylmethyl)-9-cyclohexyl-2-N-pyrazin-2-ylpurine-2,6-diamine |
| SMILES | c1ccc2[nH]c(CNc3nc(Nc4cnccn4)nc4c3ncn4C3CCCCC3)nc2c1 |
| InChI | InChI=1S/C23H24N10/c1-2-6-15(7-3-1)33-14-27-20-21(26-13-19-28-16-8-4-5-9-17(16)29-19)31-23(32-22(20)33)30-18-12-24-10-11-25-18/h4-5,8-12,14-15H,1-3,6-7,13H2,(H,28,29)(H2,25,26,30,31,32) |
| InChIKey | ZYXLIJLKPLBEQZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |