C19H25N7 — CID 117079255
9-cyclohexyl-6-N-propyl-2-N-pyridin-4-ylpurine-2,6-diamine (PubChem CID 117079255) has the molecular formula C19H25N7 and a molecular weight of 351.46 g/mol. Its IUPAC name is 9-cyclohexyl-6-N-propyl-2-N-pyridin-4-ylpurine-2,6-diamine.
| Compound Name | 9-cyclohexyl-6-N-propyl-2-N-pyridin-4-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117079255 |
| Molecular Formula | C19H25N7 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 9-cyclohexyl-6-N-propyl-2-N-pyridin-4-ylpurine-2,6-diamine |
| SMILES | CCCNc1nc(Nc2ccncc2)nc2c1ncn2C1CCCCC1 |
| InChI | InChI=1S/C19H25N7/c1-2-10-21-17-16-18(26(13-22-16)15-6-4-3-5-7-15)25-19(24-17)23-14-8-11-20-12-9-14/h8-9,11-13,15H,2-7,10H2,1H3,(H2,20,21,23,24,25) |
| InChIKey | SARCSPAPSVZUDW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |