C27H30N8O — CID 117087399
9-cyclohexyl-2-N-(1-methylbenzimidazol-2-yl)-6-N-(2-phenoxyethyl)purine-2,6-diamine (PubChem CID 117087399) has the molecular formula C27H30N8O and a molecular weight of 482.59 g/mol. Its IUPAC name is 9-cyclohexyl-2-N-(1-methylbenzimidazol-2-yl)-6-N-(2-phenoxyethyl)purine-2,6-diamine.
| Compound Name | 9-cyclohexyl-2-N-(1-methylbenzimidazol-2-yl)-6-N-(2-phenoxyethyl)purine-2,6-diamine |
|---|---|
| PubChem CID | 117087399 |
| Molecular Formula | C27H30N8O |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 9-cyclohexyl-2-N-(1-methylbenzimidazol-2-yl)-6-N-(2-phenoxyethyl)purine-2,6-diamine |
| SMILES | Cn1c(Nc2nc(NCCOc3ccccc3)c3ncn(C4CCCCC4)c3n2)nc2ccccc21 |
| InChI | InChI=1S/C27H30N8O/c1-34-22-15-9-8-14-21(22)30-27(34)33-26-31-24(28-16-17-36-20-12-6-3-7-13-20)23-25(32-26)35(18-29-23)19-10-4-2-5-11-19/h3,6-9,12-15,18-19H,2,4-5,10-11,16-17H2,1H3,(H2,28,30,31,32,33) |
| InChIKey | ROIOMYGGYCJOFZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|