C31H37N7O2 — CID 117085522
[4-[9-cyclohexyl-6-(2-phenoxyethylamino)purin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 117085522) has the molecular formula C31H37N7O2 and a molecular weight of 539.68 g/mol. Its IUPAC name is [4-[9-cyclohexyl-6-(2-phenoxyethylamino)purin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-[9-cyclohexyl-6-(2-phenoxyethylamino)purin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 117085522 |
| Molecular Formula | C31H37N7O2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | [4-[9-cyclohexyl-6-(2-phenoxyethylamino)purin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc(-c3nc(NCCOc4ccccc4)c4ncn(C5CCCCC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C31H37N7O2/c1-36-17-19-37(20-18-36)31(39)24-14-12-23(13-15-24)28-34-29(32-16-21-40-26-10-6-3-7-11-26)27-30(35-28)38(22-33-27)25-8-4-2-5-9-25/h3,6-7,10-15,22,25H,2,4-5,8-9,16-21H2,1H3,(H,32,34,35) |
| InChIKey | UNRYPYJWZDYIAG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|